C6H9FS — CID 167239113
(2Z,4Z)-3-fluorohexa-2,4-diene-2-thiol (PubChem CID 167239113) has the molecular formula C6H9FS and a molecular weight of 132.20 g/mol. Its IUPAC name is (2Z,4Z)-3-fluorohexa-2,4-diene-2-thiol.
| Compound Name | (2Z,4Z)-3-fluorohexa-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 167239113 |
| Molecular Formula | C6H9FS |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (2Z,4Z)-3-fluorohexa-2,4-diene-2-thiol |
| SMILES | C/C=C\C(F)=C(/C)S |
| InChI | InChI=1S/C6H9FS/c1-3-4-6(7)5(2)8/h3-4,8H,1-2H3/b4-3-,6-5- |
| InChIKey | CXZLRWHFQOJPBK-OUPQRBNQSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|