C8H13F — CID 123466906
4-fluoro-5-methylhepta-2,4-diene (PubChem CID 123466906) has the molecular formula C8H13F and a molecular weight of 128.19 g/mol. Its IUPAC name is 4-fluoro-5-methylhepta-2,4-diene.
| Compound Name | 4-fluoro-5-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 123466906 |
| Molecular Formula | C8H13F |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.10 |
| IUPAC Name | 4-fluoro-5-methylhepta-2,4-diene |
| SMILES | CC=CC(F)=C(C)CC |
| InChI | InChI=1S/C8H13F/c1-4-6-8(9)7(3)5-2/h4,6H,5H2,1-3H3 |
| InChIKey | XEYDDMYAIMODSH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|