C8H12F2 — CID 144768900
(2E,4Z)-2,4-difluoro-5-methylhepta-2,4-diene (PubChem CID 144768900) has the molecular formula C8H12F2 and a molecular weight of 146.18 g/mol. Its IUPAC name is (2E,4Z)-2,4-difluoro-5-methylhepta-2,4-diene.
| Compound Name | (2E,4Z)-2,4-difluoro-5-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 144768900 |
| Molecular Formula | C8H12F2 |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2E,4Z)-2,4-difluoro-5-methylhepta-2,4-diene |
| SMILES | CC/C(C)=C(F)/C=C(\C)F |
| InChI | InChI=1S/C8H12F2/c1-4-6(2)8(10)5-7(3)9/h5H,4H2,1-3H3/b7-5+,8-6- |
| InChIKey | BHOLSUFUPKAKQM-YMBWGVAGSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|