C11H17F — CID 145100268
(3Z)-3-ethyl-5-fluoro-2,6-dimethylhepta-1,3,5-triene (PubChem CID 145100268) has the molecular formula C11H17F and a molecular weight of 168.25 g/mol. Its IUPAC name is (3Z)-3-ethyl-5-fluoro-2,6-dimethylhepta-1,3,5-triene.
| Compound Name | (3Z)-3-ethyl-5-fluoro-2,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 145100268 |
| Molecular Formula | C11H17F |
| Molecular Weight | 168.25 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3Z)-3-ethyl-5-fluoro-2,6-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(=C\C(F)=C(C)C)CC |
| InChI | InChI=1S/C11H17F/c1-6-10(8(2)3)7-11(12)9(4)5/h7H,2,6H2,1,3-5H3/b10-7- |
| InChIKey | OSRWAGHDMXVZMR-YFHOEESVSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|