C10H18FN — CID 145356068
ethane;(3E)-5-fluoro-6-methylhepta-1,3,5-trien-3-amine (PubChem CID 145356068) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is ethane;(3E)-5-fluoro-6-methylhepta-1,3,5-trien-3-amine.
| Compound Name | ethane;(3E)-5-fluoro-6-methylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145356068 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | ethane;(3E)-5-fluoro-6-methylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C(F)=C(C)C.CC |
| InChI | InChI=1S/C8H12FN.C2H6/c1-4-7(10)5-8(9)6(2)3;1-2/h4-5H,1,10H2,2-3H3;1-2H3/b7-5+; |
| InChIKey | KTSGPDWRBZOBBZ-GZOLSCHFSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|