C17H23FN2 — CID 134380590
(3E,6Z)-6-[(E)-1-fluoro-2-(methylideneamino)ethenyl]-5-propan-2-ylideneundeca-1,3,6,10-tetraen-3-amine (PubChem CID 134380590) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is (3E,6Z)-6-[(E)-1-fluoro-2-(methylideneamino)ethenyl]-5-propan-2-ylideneundeca-1,3,6,10-tetraen-3-amine.
| Compound Name | (3E,6Z)-6-[(E)-1-fluoro-2-(methylideneamino)ethenyl]-5-propan-2-ylideneundeca-1,3,6,10-tetraen-3-amine |
|---|---|
| PubChem CID | 134380590 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (3E,6Z)-6-[(E)-1-fluoro-2-(methylideneamino)ethenyl]-5-propan-2-ylideneundeca-1,3,6,10-tetraen-3-amine |
| SMILES | C=CCCC=C(C(/C=C(/N)C=C)=C(C)C)/C(F)=C\N=C |
| InChI | InChI=1S/C17H23FN2/c1-6-8-9-10-15(17(18)12-20-5)16(13(3)4)11-14(19)7-2/h6-7,10-12H,1-2,5,8-9,19H2,3-4H3/b14-11+,15-10-,17-12+ |
| InChIKey | PUDJUCRFZCMEKD-CTSVMARZSA-N |
| XLogP | 4.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|