C7H9FIN — CID 88579421
N-[(1Z,3E)-5-fluoro-4-iodo-2-methylpenta-1,3-dienyl]methanimine (PubChem CID 88579421) has the molecular formula C7H9FIN and a molecular weight of 253.06 g/mol. Its IUPAC name is N-[(1Z,3E)-5-fluoro-4-iodo-2-methylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-5-fluoro-4-iodo-2-methylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 88579421 |
| Molecular Formula | C7H9FIN |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | N-[(1Z,3E)-5-fluoro-4-iodo-2-methylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C)\C=C(\I)CF |
| InChI | InChI=1S/C7H9FIN/c1-6(5-10-2)3-7(9)4-8/h3,5H,2,4H2,1H3/b6-5-,7-3+ |
| InChIKey | CGPMFAXOEVXPLR-KQVMHNMJSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|