C11H23N — CID 143747590
ethane;N-[(1E,3Z)-2-methylpenta-1,3-dienyl]methanimine (PubChem CID 143747590) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;N-[(1E,3Z)-2-methylpenta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1E,3Z)-2-methylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143747590 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;N-[(1E,3Z)-2-methylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C)/C=C\C.CC.CC |
| InChI | InChI=1S/C7H11N.2C2H6/c1-4-5-7(2)6-8-3;2*1-2/h4-6H,3H2,1-2H3;2*1-2H3/b5-4-,7-6+;; |
| InChIKey | VXHYKOLFZNBQTN-NBTOHIFCSA-N |
| XLogP | 4.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|