C11H21NOSi — CID 91435960
trimethylsilyl N-(2-methylpenta-1,3-dienyl)ethanimidate (PubChem CID 91435960) has the molecular formula C11H21NOSi and a molecular weight of 211.38 g/mol. Its IUPAC name is trimethylsilyl N-(2-methylpenta-1,3-dienyl)ethanimidate.
| Compound Name | trimethylsilyl N-(2-methylpenta-1,3-dienyl)ethanimidate |
|---|---|
| PubChem CID | 91435960 |
| Molecular Formula | C11H21NOSi |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | trimethylsilyl N-(2-methylpenta-1,3-dienyl)ethanimidate |
| SMILES | CC=CC(C)=C/N=C(\C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H21NOSi/c1-7-8-10(2)9-12-11(3)13-14(4,5)6/h7-9H,1-6H3/b8-7?,10-9?,12-11+ |
| InChIKey | SIAJUVUTNAFPBQ-CQRHZKEDSA-N |
| XLogP | 3.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|