C10H18OSi — CID 10903353
[(3E,5E)-hepta-1,3,5-trien-2-yl]oxy-trimethylsilane (PubChem CID 10903353) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is [(3E,5E)-hepta-1,3,5-trien-2-yl]oxy-trimethylsilane.
| Compound Name | [(3E,5E)-hepta-1,3,5-trien-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10903353 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | [(3E,5E)-hepta-1,3,5-trien-2-yl]oxy-trimethylsilane |
| SMILES | C=C(/C=C/C=C/C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H18OSi/c1-6-7-8-9-10(2)11-12(3,4)5/h6-9H,2H2,1,3-5H3/b7-6+,9-8+ |
| InChIKey | HHXPXXSCUBRYCG-BLHCBFLLSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|