C6H10O4 — CID 22237716
(2E,4E)-hexa-2,4-dienoic acid;hydrogen peroxide (PubChem CID 22237716) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienoic acid;hydrogen peroxide.
| Compound Name | (2E,4E)-hexa-2,4-dienoic acid;hydrogen peroxide |
|---|---|
| PubChem CID | 22237716 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienoic acid;hydrogen peroxide |
| SMILES | C/C=C/C=C/C(=O)O.OO |
| InChI | InChI=1S/C6H8O2.H2O2/c1-2-3-4-5-6(7)8;1-2/h2-5H,1H3,(H,7,8);1-2H/b3-2+,5-4+; |
| InChIKey | ZXCJOGQLZQJTHZ-STWYSWDKSA-N |
| XLogP | 1.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|