C9H14O2 — CID 158512796
hexa-2,4-dienoic acid;prop-1-ene (PubChem CID 158512796) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is hexa-2,4-dienoic acid;prop-1-ene.
| Compound Name | hexa-2,4-dienoic acid;prop-1-ene |
|---|---|
| PubChem CID | 158512796 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | hexa-2,4-dienoic acid;prop-1-ene |
| SMILES | C=CC.CC=CC=CC(=O)O |
| InChI | InChI=1S/C6H8O2.C3H6/c1-2-3-4-5-6(7)8;1-3-2/h2-5H,1H3,(H,7,8);3H,1H2,2H3 |
| InChIKey | HLGNGULXYNYWHO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|