C8H12OS — CID 142884054
(3Z,5Z)-2-methylsulfinylhepta-1,3,5-triene (PubChem CID 142884054) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is (3Z,5Z)-2-methylsulfinylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-2-methylsulfinylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142884054 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (3Z,5Z)-2-methylsulfinylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C=C/C)S(C)=O |
| InChI | InChI=1S/C8H12OS/c1-4-5-6-7-8(2)10(3)9/h4-7H,2H2,1,3H3/b5-4-,7-6- |
| InChIKey | NIJMTIPXNHHLAW-RZSVFLSASA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|