C8H9NO — CID 135173533
(3Z,5Z)-2-isocyanatohepta-1,3,5-triene (PubChem CID 135173533) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is (3Z,5Z)-2-isocyanatohepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-2-isocyanatohepta-1,3,5-triene |
|---|---|
| PubChem CID | 135173533 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (3Z,5Z)-2-isocyanatohepta-1,3,5-triene |
| SMILES | C=C(/C=C\C=C/C)N=C=O |
| InChI | InChI=1S/C8H9NO/c1-3-4-5-6-8(2)9-7-10/h3-6H,2H2,1H3/b4-3-,6-5- |
| InChIKey | PFSUJLGBEOQXDJ-OUPQRBNQSA-N |
| XLogP | 1.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|