C17H19N — CID 144989648
N-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-2-yl]-1-phenylethanimine (PubChem CID 144989648) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is N-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-2-yl]-1-phenylethanimine.
| Compound Name | N-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-2-yl]-1-phenylethanimine |
|---|---|
| PubChem CID | 144989648 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-2-yl]-1-phenylethanimine |
| SMILES | C=C(/C=C/C=C\C=C/C)/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-4-5-6-7-9-12-15(2)18-16(3)17-13-10-8-11-14-17/h4-14H,2H2,1,3H3/b5-4-,7-6-,12-9+,18-16+ |
| InChIKey | ILONOQFTHSBTNP-SZZXMTDHSA-N |
| XLogP | 4.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|