C13H13Br — CID 126693561
[(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]benzene (PubChem CID 126693561) has the molecular formula C13H13Br and a molecular weight of 249.15 g/mol. Its IUPAC name is [(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]benzene.
| Compound Name | [(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 126693561 |
| Molecular Formula | C13H13Br |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | [(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]benzene |
| SMILES | C/C=C\C=C/C(=C/Br)c1ccccc1 |
| InChI | InChI=1S/C13H13Br/c1-2-3-5-10-13(11-14)12-8-6-4-7-9-12/h2-11H,1H3/b3-2-,10-5-,13-11- |
| InChIKey | PRTUTKPUBRECBU-YRTVCABGSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|