(2Z,4E)-3-phenylhexa-2,4-dienoic acid

C12H12O2 — CID 10397589

IUPAC(2Z,4E)-3-phenylhexa-2,4-dienoic acid
SMILESC/C=C/C(=C/C(=O)O)c1ccccc1
InChIInChI=1S/C12H12O2/c1-2-6-11(9-12(13)14)10-7-4-3-5-8-10/h2-9H,1H3,(H,13,14)/b6-2+,11-9-
InChIKeyAAGKPJCACLGJMK-QXBMDZOZSA-N
MW188.23 g/mol
LogP2.73
Rot. Bonds3

About (2Z,4E)-3-phenylhexa-2,4-dienoic acid

(2Z,4E)-3-phenylhexa-2,4-dienoic acid (PubChem CID 10397589) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2Z,4E)-3-phenylhexa-2,4-dienoic acid.

Molecular Properties

Compound Name(2Z,4E)-3-phenylhexa-2,4-dienoic acid
PubChem CID10397589
Molecular FormulaC12H12O2
Molecular Weight188.23 g/mol
Exact Mass188.08
IUPAC Name(2Z,4E)-3-phenylhexa-2,4-dienoic acid
SMILESC/C=C/C(=C/C(=O)O)c1ccccc1
InChIInChI=1S/C12H12O2/c1-2-6-11(9-12(13)14)10-7-4-3-5-8-10/h2-9H,1H3,(H,13,14)/b6-2+,11-9-
InChIKeyAAGKPJCACLGJMK-QXBMDZOZSA-N
XLogP2.73
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.23
LogP ≤ 52.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2Z,4E)-3-phenylhexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4E)-3-phenylhexa-2,4-dienoic acid?
The IUPAC name of (2Z,4E)-3-phenylhexa-2,4-dienoic acid (CID 10397589) is (2Z,4E)-3-phenylhexa-2,4-dienoic acid.
What is the SMILES notation for (2Z,4E)-3-phenylhexa-2,4-dienoic acid?
The canonical SMILES for (2Z,4E)-3-phenylhexa-2,4-dienoic acid is C/C=C/C(=C/C(=O)O)c1ccccc1.
What is the InChIKey of (2Z,4E)-3-phenylhexa-2,4-dienoic acid?
The InChIKey is AAGKPJCACLGJMK-QXBMDZOZSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-6-11(9-12(13)14)10-7-4-3-5-8-10/h2-9H,1H3,(H,13,14)/b6-2+,11-9-.
What are the key properties of (2Z,4E)-3-phenylhexa-2,4-dienoic acid?
(2Z,4E)-3-phenylhexa-2,4-dienoic acid has a molecular weight of 188.23 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-3-phenylhexa-2,4-dienoic acid is sourced from PubChem (CID 10397589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).