C20H22S — CID 170266079
(2E,4E,7E,9Z)-5-ethenyl-6-methylidene-8-phenylundeca-2,4,7,9-tetraene-3-thiol (PubChem CID 170266079) has the molecular formula C20H22S and a molecular weight of 294.46 g/mol. Its IUPAC name is (2E,4E,7E,9Z)-5-ethenyl-6-methylidene-8-phenylundeca-2,4,7,9-tetraene-3-thiol.
| Compound Name | (2E,4E,7E,9Z)-5-ethenyl-6-methylidene-8-phenylundeca-2,4,7,9-tetraene-3-thiol |
|---|---|
| PubChem CID | 170266079 |
| Molecular Formula | C20H22S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2E,4E,7E,9Z)-5-ethenyl-6-methylidene-8-phenylundeca-2,4,7,9-tetraene-3-thiol |
| SMILES | C=C/C(=C\C(S)=C/C)C(=C)/C=C(\C=C/C)c1ccccc1 |
| InChI | InChI=1S/C20H22S/c1-5-11-19(18-12-9-8-10-13-18)14-16(4)17(6-2)15-20(21)7-3/h5-15,21H,2,4H2,1,3H3/b11-5-,17-15+,19-14+,20-7+ |
| InChIKey | UIWVWZLKGLFPBL-YPAIFODLSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|