C35H42 — CID 142469927
ethane;[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene;toluene (PubChem CID 142469927) has the molecular formula C35H42 and a molecular weight of 462.72 g/mol. Its IUPAC name is ethane;[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene;toluene.
| Compound Name | ethane;[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene;toluene |
|---|---|
| PubChem CID | 142469927 |
| Molecular Formula | C35H42 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | ethane;[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzene;toluene |
| SMILES | C=C(/C=C\C=C/C)c1ccccc1.C=C/C=C(\C=C/C)c1ccccc1.CC.Cc1ccccc1 |
| InChI | InChI=1S/2C13H14.C7H8.C2H6/c1-3-4-6-9-12(2)13-10-7-5-8-11-13;1-3-8-12(9-4-2)13-10-6-5-7-11-13;1-7-5-3-2-4-6-7;1-2/h3-11H,2H2,1H3;3-11H,1H2,2H3;2-6H,1H3;1-2H3/b4-3-,9-6-;9-4-,12-8+;; |
| InChIKey | GMCZHYIRSJQJRH-AHSCPAAZSA-N |
| XLogP | 10.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|