C15H16 — CID 143222208
1-ethenyl-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene (PubChem CID 143222208) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-ethenyl-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene.
| Compound Name | 1-ethenyl-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene |
|---|---|
| PubChem CID | 143222208 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-ethenyl-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene |
| SMILES | C=Cc1ccc(C(=C)/C=C\C=C/C)cc1 |
| InChI | InChI=1S/C15H16/c1-4-6-7-8-13(3)15-11-9-14(5-2)10-12-15/h4-12H,2-3H2,1H3/b6-4-,8-7- |
| InChIKey | VLBUFCHZVAZPKZ-MOIRPGTBSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|