C11H11Br — CID 144724093
1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene (PubChem CID 144724093) has the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. Its IUPAC name is 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene.
| Compound Name | 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene |
|---|---|
| PubChem CID | 144724093 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 1-bromo-4-[(3Z)-penta-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C=C\C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H11Br/c1-3-4-9(2)10-5-7-11(12)8-6-10/h3-8H,2H2,1H3/b4-3- |
| InChIKey | RGCMJFLIODYALC-ARJAWSKDSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|