About 4-[(3Z)-penta-1,3-dien-2-yl]pyridine
4-[(3Z)-penta-1,3-dien-2-yl]pyridine (PubChem CID 118479579) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-[(3Z)-penta-1,3-dien-2-yl]pyridine.
Molecular Properties
| Compound Name | 4-[(3Z)-penta-1,3-dien-2-yl]pyridine |
| PubChem CID | 118479579 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 4-[(3Z)-penta-1,3-dien-2-yl]pyridine |
| SMILES | C=C(/C=C\C)c1ccncc1 |
| InChI | InChI=1S/C10H11N/c1-3-4-9(2)10-5-7-11-8-6-10/h3-8H,2H2,1H3/b4-3- |
| InChIKey | XCTCCTVYOUBBFW-ARJAWSKDSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3Z)-penta-1,3-dien-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3Z)-penta-1,3-dien-2-yl]pyridine?
The IUPAC name of 4-[(3Z)-penta-1,3-dien-2-yl]pyridine (CID 118479579) is 4-[(3Z)-penta-1,3-dien-2-yl]pyridine.
What is the SMILES notation for 4-[(3Z)-penta-1,3-dien-2-yl]pyridine?
The canonical SMILES for 4-[(3Z)-penta-1,3-dien-2-yl]pyridine is C=C(/C=C\C)c1ccncc1.
What is the InChIKey of 4-[(3Z)-penta-1,3-dien-2-yl]pyridine?
The InChIKey is XCTCCTVYOUBBFW-ARJAWSKDSA-N. The full InChI is InChI=1S/C10H11N/c1-3-4-9(2)10-5-7-11-8-6-10/h3-8H,2H2,1H3/b4-3-.
What are the key properties of 4-[(3Z)-penta-1,3-dien-2-yl]pyridine?
4-[(3Z)-penta-1,3-dien-2-yl]pyridine has a molecular weight of 145.20 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3Z)-penta-1,3-dien-2-yl]pyridine is sourced from PubChem (CID 118479579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).