C27H21N3 — CID 90806125
4-[1-[3,5-bis(1-pyridin-4-ylethenyl)phenyl]ethenyl]pyridine (PubChem CID 90806125) has the molecular formula C27H21N3 and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-[1-[3,5-bis(1-pyridin-4-ylethenyl)phenyl]ethenyl]pyridine.
| Compound Name | 4-[1-[3,5-bis(1-pyridin-4-ylethenyl)phenyl]ethenyl]pyridine |
|---|---|
| PubChem CID | 90806125 |
| Molecular Formula | C27H21N3 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[1-[3,5-bis(1-pyridin-4-ylethenyl)phenyl]ethenyl]pyridine |
| SMILES | C=C(c1ccncc1)c1cc(C(=C)c2ccncc2)cc(C(=C)c2ccncc2)c1 |
| InChI | InChI=1S/C27H21N3/c1-19(22-4-10-28-11-5-22)25-16-26(20(2)23-6-12-29-13-7-23)18-27(17-25)21(3)24-8-14-30-15-9-24/h4-18H,1-3H2 |
| InChIKey | LSOCVBXJMLQNSV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |