About pyridine-4-carbothioyl chloride
pyridine-4-carbothioyl chloride (PubChem CID 18800884) has the molecular formula C6H4ClNS
and a molecular weight of 157.62 g/mol. Its IUPAC name is pyridine-4-carbothioyl chloride.
Molecular Properties
| Compound Name | pyridine-4-carbothioyl chloride |
| PubChem CID | 18800884 |
| Molecular Formula | C6H4ClNS |
| Molecular Weight | 157.62 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | pyridine-4-carbothioyl chloride |
| SMILES | S=C(Cl)c1ccncc1 |
| InChI | InChI=1S/C6H4ClNS/c7-6(9)5-1-3-8-4-2-5/h1-4H |
| InChIKey | HOERXXHIWHTSBN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridine-4-carbothioyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-4-carbothioyl chloride?
The IUPAC name of pyridine-4-carbothioyl chloride (CID 18800884) is pyridine-4-carbothioyl chloride.
What is the SMILES notation for pyridine-4-carbothioyl chloride?
The canonical SMILES for pyridine-4-carbothioyl chloride is S=C(Cl)c1ccncc1.
What is the InChIKey of pyridine-4-carbothioyl chloride?
The InChIKey is HOERXXHIWHTSBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNS/c7-6(9)5-1-3-8-4-2-5/h1-4H.
What are the key properties of pyridine-4-carbothioyl chloride?
pyridine-4-carbothioyl chloride has a molecular weight of 157.62 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-4-carbothioyl chloride is sourced from PubChem (CID 18800884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).