About lithium;pyridine-4-carboxylate;dihydrate
lithium;pyridine-4-carboxylate;dihydrate (PubChem CID 172830071) has the molecular formula C6H8LiNO4
and a molecular weight of 165.07 g/mol. Its IUPAC name is lithium;pyridine-4-carboxylate;dihydrate.
Molecular Properties
| Compound Name | lithium;pyridine-4-carboxylate;dihydrate |
| PubChem CID | 172830071 |
| Molecular Formula | C6H8LiNO4 |
| Molecular Weight | 165.07 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | lithium;pyridine-4-carboxylate;dihydrate |
| SMILES | O.O.O=C([O-])c1ccncc1.[Li+] |
| InChI | InChI=1S/C6H5NO2.Li.2H2O/c8-6(9)5-1-3-7-4-2-5;;;/h1-4H,(H,8,9);;2*1H2/q;+1;;/p-1 |
| InChIKey | VJXHUWKTOJRTBB-UHFFFAOYSA-M |
| XLogP | -5.20 |
| TPSA | 116.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.07 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;pyridine-4-carboxylate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;pyridine-4-carboxylate;dihydrate?
The IUPAC name of lithium;pyridine-4-carboxylate;dihydrate (CID 172830071) is lithium;pyridine-4-carboxylate;dihydrate.
What is the SMILES notation for lithium;pyridine-4-carboxylate;dihydrate?
The canonical SMILES for lithium;pyridine-4-carboxylate;dihydrate is O.O.O=C([O-])c1ccncc1.[Li+].
What is the InChIKey of lithium;pyridine-4-carboxylate;dihydrate?
The InChIKey is VJXHUWKTOJRTBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.Li.2H2O/c8-6(9)5-1-3-7-4-2-5;;;/h1-4H,(H,8,9);;2*1H2/q;+1;;/p-1.
What are the key properties of lithium;pyridine-4-carboxylate;dihydrate?
lithium;pyridine-4-carboxylate;dihydrate has a molecular weight of 165.07 g/mol, XLogP of -5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;pyridine-4-carboxylate;dihydrate is sourced from PubChem (CID 172830071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).