About formyl pyridine-4-carboxylate
formyl pyridine-4-carboxylate (PubChem CID 54232174) has the molecular formula C7H5NO3
and a molecular weight of 151.12 g/mol. Its IUPAC name is formyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | formyl pyridine-4-carboxylate |
| PubChem CID | 54232174 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | formyl pyridine-4-carboxylate |
| SMILES | O=COC(=O)c1ccncc1 |
| InChI | InChI=1S/C7H5NO3/c9-5-11-7(10)6-1-3-8-4-2-6/h1-5H |
| InChIKey | KFQJJLHUCUEUGH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl pyridine-4-carboxylate?
The IUPAC name of formyl pyridine-4-carboxylate (CID 54232174) is formyl pyridine-4-carboxylate.
What is the SMILES notation for formyl pyridine-4-carboxylate?
The canonical SMILES for formyl pyridine-4-carboxylate is O=COC(=O)c1ccncc1.
What is the InChIKey of formyl pyridine-4-carboxylate?
The InChIKey is KFQJJLHUCUEUGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c9-5-11-7(10)6-1-3-8-4-2-6/h1-5H.
What are the key properties of formyl pyridine-4-carboxylate?
formyl pyridine-4-carboxylate has a molecular weight of 151.12 g/mol, XLogP of 0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formyl pyridine-4-carboxylate is sourced from PubChem (CID 54232174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).