About dichloroplatinum;bis(methyl pyridine-4-carboxylate)
dichloroplatinum;bis(methyl pyridine-4-carboxylate) (PubChem CID 4684281) has the molecular formula C14H14Cl2N2O4Pt
and a molecular weight of 540.26 g/mol. Its IUPAC name is dichloroplatinum;bis(methyl pyridine-4-carboxylate).
Molecular Properties
| Compound Name | dichloroplatinum;bis(methyl pyridine-4-carboxylate) |
| PubChem CID | 4684281 |
| Molecular Formula | C14H14Cl2N2O4Pt |
| Molecular Weight | 540.26 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | dichloroplatinum;bis(methyl pyridine-4-carboxylate) |
| SMILES | COC(=O)c1ccncc1.COC(=O)c1ccncc1.Cl[Pt]Cl |
| InChI | InChI=1S/2C7H7NO2.2ClH.Pt/c2*1-10-7(9)6-2-4-8-5-3-6;;;/h2*2-5H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | HZNFHQPQINSODV-UHFFFAOYSA-L |
| XLogP | 3.11 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dichloroplatinum;bis(methyl pyridine-4-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;bis(methyl pyridine-4-carboxylate)?
The IUPAC name of dichloroplatinum;bis(methyl pyridine-4-carboxylate) (CID 4684281) is dichloroplatinum;bis(methyl pyridine-4-carboxylate).
What is the SMILES notation for dichloroplatinum;bis(methyl pyridine-4-carboxylate)?
The canonical SMILES for dichloroplatinum;bis(methyl pyridine-4-carboxylate) is COC(=O)c1ccncc1.COC(=O)c1ccncc1.Cl[Pt]Cl.
What is the InChIKey of dichloroplatinum;bis(methyl pyridine-4-carboxylate)?
The InChIKey is HZNFHQPQINSODV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H7NO2.2ClH.Pt/c2*1-10-7(9)6-2-4-8-5-3-6;;;/h2*2-5H,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroplatinum;bis(methyl pyridine-4-carboxylate)?
dichloroplatinum;bis(methyl pyridine-4-carboxylate) has a molecular weight of 540.26 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;bis(methyl pyridine-4-carboxylate) is sourced from PubChem (CID 4684281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).