About methyl pyridine-4-carboxylate;pentanamide
methyl pyridine-4-carboxylate;pentanamide (PubChem CID 174992063) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl pyridine-4-carboxylate;pentanamide.
Molecular Properties
| Compound Name | methyl pyridine-4-carboxylate;pentanamide |
| PubChem CID | 174992063 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl pyridine-4-carboxylate;pentanamide |
| SMILES | CCCCC(N)=O.COC(=O)c1ccncc1 |
| InChI | InChI=1S/C7H7NO2.C5H11NO/c1-10-7(9)6-2-4-8-5-3-6;1-2-3-4-5(6)7/h2-5H,1H3;2-4H2,1H3,(H2,6,7) |
| InChIKey | ARCAJYXKTOIFIU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl pyridine-4-carboxylate;pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl pyridine-4-carboxylate;pentanamide?
The IUPAC name of methyl pyridine-4-carboxylate;pentanamide (CID 174992063) is methyl pyridine-4-carboxylate;pentanamide.
What is the SMILES notation for methyl pyridine-4-carboxylate;pentanamide?
The canonical SMILES for methyl pyridine-4-carboxylate;pentanamide is CCCCC(N)=O.COC(=O)c1ccncc1.
What is the InChIKey of methyl pyridine-4-carboxylate;pentanamide?
The InChIKey is ARCAJYXKTOIFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C5H11NO/c1-10-7(9)6-2-4-8-5-3-6;1-2-3-4-5(6)7/h2-5H,1H3;2-4H2,1H3,(H2,6,7).
What are the key properties of methyl pyridine-4-carboxylate;pentanamide?
methyl pyridine-4-carboxylate;pentanamide has a molecular weight of 238.29 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl pyridine-4-carboxylate;pentanamide is sourced from PubChem (CID 174992063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).