C18H21NO2 — CID 134080804
methyl 4-(2,2-dimethyl-1-pyridin-4-ylpropyl)benzoate (PubChem CID 134080804) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 4-(2,2-dimethyl-1-pyridin-4-ylpropyl)benzoate.
| Compound Name | methyl 4-(2,2-dimethyl-1-pyridin-4-ylpropyl)benzoate |
|---|---|
| PubChem CID | 134080804 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | methyl 4-(2,2-dimethyl-1-pyridin-4-ylpropyl)benzoate |
| SMILES | COC(=O)c1ccc(C(c2ccncc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-18(2,3)16(14-9-11-19-12-10-14)13-5-7-15(8-6-13)17(20)21-4/h5-12,16H,1-4H3 |
| InChIKey | NWPDNZMYFBGGHL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |