C17H20N2O2 — CID 134080788
methyl 4-(2,2-dimethyl-1-pyrazin-2-ylpropyl)benzoate (PubChem CID 134080788) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl 4-(2,2-dimethyl-1-pyrazin-2-ylpropyl)benzoate.
| Compound Name | methyl 4-(2,2-dimethyl-1-pyrazin-2-ylpropyl)benzoate |
|---|---|
| PubChem CID | 134080788 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | methyl 4-(2,2-dimethyl-1-pyrazin-2-ylpropyl)benzoate |
| SMILES | COC(=O)c1ccc(C(c2cnccn2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H20N2O2/c1-17(2,3)15(14-11-18-9-10-19-14)12-5-7-13(8-6-12)16(20)21-4/h5-11,15H,1-4H3 |
| InChIKey | RNFKNAYOGXVGDM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |