About [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate
[3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate (PubChem CID 4582342) has the molecular formula C18H12N2O4
and a molecular weight of 320.30 g/mol. Its IUPAC name is [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate |
| PubChem CID | 4582342 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate |
| SMILES | O=C(Oc1cccc(OC(=O)c2ccncc2)c1)c1ccncc1 |
| InChI | InChI=1S/C18H12N2O4/c21-17(13-4-8-19-9-5-13)23-15-2-1-3-16(12-15)24-18(22)14-6-10-20-11-7-14/h1-12H |
| InChIKey | NEMASRXSZDBWMF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
The IUPAC name of [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate (CID 4582342) is [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate.
What is the SMILES notation for [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
The canonical SMILES for [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate is O=C(Oc1cccc(OC(=O)c2ccncc2)c1)c1ccncc1.
What is the InChIKey of [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
The InChIKey is NEMASRXSZDBWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O4/c21-17(13-4-8-19-9-5-13)23-15-2-1-3-16(12-15)24-18(22)14-6-10-20-11-7-14/h1-12H.
What are the key properties of [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
[3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate has a molecular weight of 320.30 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate is sourced from PubChem (CID 4582342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).