About diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate
diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate (PubChem CID 23310708) has the molecular formula C22H20N2O8
and a molecular weight of 440.41 g/mol. Its IUPAC name is diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate.
Molecular Properties
| Compound Name | diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate |
| PubChem CID | 23310708 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate |
| SMILES | O=C([O-])c1cccc(C(=O)Oc2cccc(OC(=O)c3cccc(C(=O)[O-])c3)c2)c1.[NH4+].[NH4+] |
| InChI | InChI=1S/C22H14O8.2H3N/c23-19(24)13-4-1-6-15(10-13)21(27)29-17-8-3-9-18(12-17)30-22(28)16-7-2-5-14(11-16)20(25)26;;/h1-12H,(H,23,24)(H,25,26);2*1H3 |
| InChIKey | QBAPFVHUIXNYCJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 205.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate?
The IUPAC name of diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate (CID 23310708) is diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate.
What is the SMILES notation for diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate?
The canonical SMILES for diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate is O=C([O-])c1cccc(C(=O)Oc2cccc(OC(=O)c3cccc(C(=O)[O-])c3)c2)c1.[NH4+].[NH4+].
What is the InChIKey of diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate?
The InChIKey is QBAPFVHUIXNYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14O8.2H3N/c23-19(24)13-4-1-6-15(10-13)21(27)29-17-8-3-9-18(12-17)30-22(28)16-7-2-5-14(11-16)20(25)26;;/h1-12H,(H,23,24)(H,25,26);2*1H3.
What are the key properties of diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate?
diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate has a molecular weight of 440.41 g/mol, XLogP of 1.60, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;3-[3-(3-carboxylatobenzoyl)oxyphenoxy]carbonylbenzoate is sourced from PubChem (CID 23310708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).