About pyridin-4-yl 4-methylbenzoate
pyridin-4-yl 4-methylbenzoate (PubChem CID 12624128) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is pyridin-4-yl 4-methylbenzoate.
Molecular Properties
| Compound Name | pyridin-4-yl 4-methylbenzoate |
| PubChem CID | 12624128 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | pyridin-4-yl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccncc2)cc1 |
| InChI | InChI=1S/C13H11NO2/c1-10-2-4-11(5-3-10)13(15)16-12-6-8-14-9-7-12/h2-9H,1H3 |
| InChIKey | HJZURONUXKXKNX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-4-yl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-yl 4-methylbenzoate?
The IUPAC name of pyridin-4-yl 4-methylbenzoate (CID 12624128) is pyridin-4-yl 4-methylbenzoate.
What is the SMILES notation for pyridin-4-yl 4-methylbenzoate?
The canonical SMILES for pyridin-4-yl 4-methylbenzoate is Cc1ccc(C(=O)Oc2ccncc2)cc1.
What is the InChIKey of pyridin-4-yl 4-methylbenzoate?
The InChIKey is HJZURONUXKXKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c1-10-2-4-11(5-3-10)13(15)16-12-6-8-14-9-7-12/h2-9H,1H3.
What are the key properties of pyridin-4-yl 4-methylbenzoate?
pyridin-4-yl 4-methylbenzoate has a molecular weight of 213.24 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-yl 4-methylbenzoate is sourced from PubChem (CID 12624128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).