About ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate
ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate (PubChem CID 145376493) has the molecular formula C25H30N2O2
and a molecular weight of 390.53 g/mol. Its IUPAC name is ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate |
| PubChem CID | 145376493 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate |
| SMILES | CC.CC.Cc1ccc(/N=N/c2ccc(OC(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O2.2C2H6/c1-15-3-7-17(8-4-15)21(24)25-20-13-11-19(12-14-20)23-22-18-9-5-16(2)6-10-18;2*1-2/h3-14H,1-2H3;2*1-2H3/b23-22+;; |
| InChIKey | SKIHBVVPHJKQQB-VPMNAVQSSA-N |
| XLogP | 7.99 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate?
The IUPAC name of ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate (CID 145376493) is ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate.
What is the SMILES notation for ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate?
The canonical SMILES for ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate is CC.CC.Cc1ccc(/N=N/c2ccc(OC(=O)c3ccc(C)cc3)cc2)cc1.
What is the InChIKey of ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate?
The InChIKey is SKIHBVVPHJKQQB-VPMNAVQSSA-N. The full InChI is InChI=1S/C21H18N2O2.2C2H6/c1-15-3-7-17(8-4-15)21(24)25-20-13-11-19(12-14-20)23-22-18-9-5-16(2)6-10-18;2*1-2/h3-14H,1-2H3;2*1-2H3/b23-22+;;.
What are the key properties of ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate?
ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate has a molecular weight of 390.53 g/mol, XLogP of 7.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-[(4-methylphenyl)diazenyl]phenyl] 4-methylbenzoate is sourced from PubChem (CID 145376493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).