About 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate
4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate (PubChem CID 20695320) has the molecular formula C17H9NO4
and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate |
| PubChem CID | 20695320 |
| Molecular Formula | C17H9NO4 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate |
| SMILES | O=C(OC#CC#COC(=O)c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C17H9NO4/c19-16(14-6-2-1-3-7-14)21-12-4-5-13-22-17(20)15-8-10-18-11-9-15/h1-3,6-11H |
| InChIKey | WLQXGSRICNSDTI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate?
The IUPAC name of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate (CID 20695320) is 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate.
What is the SMILES notation for 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate?
The canonical SMILES for 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate is O=C(OC#CC#COC(=O)c1ccncc1)c1ccccc1.
What is the InChIKey of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate?
The InChIKey is WLQXGSRICNSDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9NO4/c19-16(14-6-2-1-3-7-14)21-12-4-5-13-22-17(20)15-8-10-18-11-9-15/h1-3,6-11H.
What are the key properties of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate?
4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate has a molecular weight of 291.26 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate is sourced from PubChem (CID 20695320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).