About phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile
phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile (PubChem CID 67912656) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile |
| PubChem CID | 67912656 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1.O=C(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C12H9NO.C6H4N2/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11;7-5-6-1-3-8-4-2-6/h1-9H;1-4H |
| InChIKey | UANZPMGVCPFOKR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile?
The IUPAC name of phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile (CID 67912656) is phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile.
What is the SMILES notation for phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile?
The canonical SMILES for phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile is N#Cc1ccncc1.O=C(c1ccccc1)c1ccncc1.
What is the InChIKey of phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile?
The InChIKey is UANZPMGVCPFOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.C6H4N2/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11;7-5-6-1-3-8-4-2-6/h1-9H;1-4H.
What are the key properties of phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile?
phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile has a molecular weight of 287.32 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(pyridin-4-yl)methanone;pyridine-4-carbonitrile is sourced from PubChem (CID 67912656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).