About 3-aminoprop-1-ynyl benzoate
3-aminoprop-1-ynyl benzoate (PubChem CID 90271975) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-aminoprop-1-ynyl benzoate.
Molecular Properties
| Compound Name | 3-aminoprop-1-ynyl benzoate |
| PubChem CID | 90271975 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-aminoprop-1-ynyl benzoate |
| SMILES | NCC#COC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9NO2/c11-7-4-8-13-10(12)9-5-2-1-3-6-9/h1-3,5-6H,7,11H2 |
| InChIKey | KNNFGMFRLYZCLC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoprop-1-ynyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoprop-1-ynyl benzoate?
The IUPAC name of 3-aminoprop-1-ynyl benzoate (CID 90271975) is 3-aminoprop-1-ynyl benzoate.
What is the SMILES notation for 3-aminoprop-1-ynyl benzoate?
The canonical SMILES for 3-aminoprop-1-ynyl benzoate is NCC#COC(=O)c1ccccc1.
What is the InChIKey of 3-aminoprop-1-ynyl benzoate?
The InChIKey is KNNFGMFRLYZCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c11-7-4-8-13-10(12)9-5-2-1-3-6-9/h1-3,5-6H,7,11H2.
What are the key properties of 3-aminoprop-1-ynyl benzoate?
3-aminoprop-1-ynyl benzoate has a molecular weight of 175.19 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoprop-1-ynyl benzoate is sourced from PubChem (CID 90271975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).