About butan-1-amine;cyano benzoate
butan-1-amine;cyano benzoate (PubChem CID 156506579) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is butan-1-amine;cyano benzoate.
Molecular Properties
| Compound Name | butan-1-amine;cyano benzoate |
| PubChem CID | 156506579 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | butan-1-amine;cyano benzoate |
| SMILES | CCCCN.N#COC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H5NO2.C4H11N/c9-6-11-8(10)7-4-2-1-3-5-7;1-2-3-4-5/h1-5H;2-5H2,1H3 |
| InChIKey | DPYUGCRYTZGQDD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;cyano benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;cyano benzoate?
The IUPAC name of butan-1-amine;cyano benzoate (CID 156506579) is butan-1-amine;cyano benzoate.
What is the SMILES notation for butan-1-amine;cyano benzoate?
The canonical SMILES for butan-1-amine;cyano benzoate is CCCCN.N#COC(=O)c1ccccc1.
What is the InChIKey of butan-1-amine;cyano benzoate?
The InChIKey is DPYUGCRYTZGQDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C4H11N/c9-6-11-8(10)7-4-2-1-3-5-7;1-2-3-4-5/h1-5H;2-5H2,1H3.
What are the key properties of butan-1-amine;cyano benzoate?
butan-1-amine;cyano benzoate has a molecular weight of 220.27 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;cyano benzoate is sourced from PubChem (CID 156506579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).