About 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene
4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene (PubChem CID 160763613) has the molecular formula C27H17N5O4
and a molecular weight of 475.46 g/mol. Its IUPAC name is 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene.
Molecular Properties
| Compound Name | 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene |
| PubChem CID | 160763613 |
| Molecular Formula | C27H17N5O4 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene |
| SMILES | O=C(OC#CC#COC(=O)c1ccncc1)c1ccccc1.c1cc(/N=N/c2ccncc2)ccn1 |
| InChI | InChI=1S/C17H9NO4.C10H8N4/c19-16(14-6-2-1-3-7-14)21-12-4-5-13-22-17(20)15-8-10-18-11-9-15;1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10/h1-3,6-11H;1-8H/b;14-13+ |
| InChIKey | RYJVSCYXVZJZHE-SLTJUJPSSA-N |
| XLogP | 4.91 |
| TPSA | 115.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene?
The IUPAC name of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene (CID 160763613) is 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene.
What is the SMILES notation for 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene?
The canonical SMILES for 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene is O=C(OC#CC#COC(=O)c1ccncc1)c1ccccc1.c1cc(/N=N/c2ccncc2)ccn1.
What is the InChIKey of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene?
The InChIKey is RYJVSCYXVZJZHE-SLTJUJPSSA-N. The full InChI is InChI=1S/C17H9NO4.C10H8N4/c19-16(14-6-2-1-3-7-14)21-12-4-5-13-22-17(20)15-8-10-18-11-9-15;1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10/h1-3,6-11H;1-8H/b;14-13+.
What are the key properties of 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene?
4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene has a molecular weight of 475.46 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyloxybuta-1,3-diynyl pyridine-4-carboxylate;dipyridin-4-yldiazene is sourced from PubChem (CID 160763613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).