About 3-methylbutyl pyridine-4-carboxylate
3-methylbutyl pyridine-4-carboxylate (PubChem CID 12509138) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-methylbutyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutyl pyridine-4-carboxylate |
| PubChem CID | 12509138 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-methylbutyl pyridine-4-carboxylate |
| SMILES | CC(C)CCOC(=O)c1ccncc1 |
| InChI | InChI=1S/C11H15NO2/c1-9(2)5-8-14-11(13)10-3-6-12-7-4-10/h3-4,6-7,9H,5,8H2,1-2H3 |
| InChIKey | KGQUNQWWGBOOJX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylbutyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl pyridine-4-carboxylate?
The IUPAC name of 3-methylbutyl pyridine-4-carboxylate (CID 12509138) is 3-methylbutyl pyridine-4-carboxylate.
What is the SMILES notation for 3-methylbutyl pyridine-4-carboxylate?
The canonical SMILES for 3-methylbutyl pyridine-4-carboxylate is CC(C)CCOC(=O)c1ccncc1.
What is the InChIKey of 3-methylbutyl pyridine-4-carboxylate?
The InChIKey is KGQUNQWWGBOOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-9(2)5-8-14-11(13)10-3-6-12-7-4-10/h3-4,6-7,9H,5,8H2,1-2H3.
What are the key properties of 3-methylbutyl pyridine-4-carboxylate?
3-methylbutyl pyridine-4-carboxylate has a molecular weight of 193.25 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl pyridine-4-carboxylate is sourced from PubChem (CID 12509138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).