C62H52N2 — CID 143067180
[(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;N-methyl-4-phenyl-N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]aniline (PubChem CID 143067180) has the molecular formula C62H52N2 and a molecular weight of 825.11 g/mol. Its IUPAC name is [(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;N-methyl-4-phenyl-N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]aniline.
| Compound Name | [(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;N-methyl-4-phenyl-N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 143067180 |
| Molecular Formula | C62H52N2 |
| Molecular Weight | 825.11 g/mol |
| Exact Mass | 824.41 |
| IUPAC Name | [(3Z,5Z)-hepta-1,3,5-trien-2-yl]benzene;N-methyl-4-phenyl-N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]aniline |
| SMILES | C=C(/C=C\C=C/C)c1ccccc1.CN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C49H38N2.C13H14/c1-50(45-27-17-40(18-28-45)37-11-5-2-6-12-37)46-29-19-43(20-30-46)44-25-35-49(36-26-44)51(47-31-21-41(22-32-47)38-13-7-3-8-14-38)48-33-23-42(24-34-48)39-15-9-4-10-16-39;1-3-4-6-9-12(2)13-10-7-5-8-11-13/h2-36H,1H3;3-11H,2H2,1H3/b;4-3-,9-6- |
| InChIKey | LYCLEZMYFQCKSZ-LFCPTJCFSA-N |
| XLogP | 17.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.11 |
| LogP ≤ 5 | 17.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|