C49H38N2 — CID 130181076
N-[4-[(3Z,5E)-5-carbazol-9-ylhepta-1,3,5-trien-2-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 130181076) has the molecular formula C49H38N2 and a molecular weight of 654.86 g/mol. Its IUPAC name is N-[4-[(3Z,5E)-5-carbazol-9-ylhepta-1,3,5-trien-2-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-[4-[(3Z,5E)-5-carbazol-9-ylhepta-1,3,5-trien-2-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 130181076 |
| Molecular Formula | C49H38N2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | N-[4-[(3Z,5E)-5-carbazol-9-ylhepta-1,3,5-trien-2-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | C=C(/C=C\C(=C/C)n1c2ccccc2c2ccccc21)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C49H38N2/c1-3-42(51-48-20-12-10-18-46(48)47-19-11-13-21-49(47)51)29-22-36(2)37-23-30-43(31-24-37)50(44-32-25-40(26-33-44)38-14-6-4-7-15-38)45-34-27-41(28-35-45)39-16-8-5-9-17-39/h3-35H,2H2,1H3/b29-22-,42-3+ |
| InChIKey | HRIGRXIJCMJTAD-OIJIHORVSA-N |
| XLogP | 13.73 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|