C39H29N3O2 — CID 156568725
1-(3-carbazol-9-ylphenyl)-3-[(2E,4Z)-6-phenylhepta-2,4,6-trien-3-yl]quinazoline-2,4-dione (PubChem CID 156568725) has the molecular formula C39H29N3O2 and a molecular weight of 571.68 g/mol. Its IUPAC name is 1-(3-carbazol-9-ylphenyl)-3-[(2E,4Z)-6-phenylhepta-2,4,6-trien-3-yl]quinazoline-2,4-dione.
| Compound Name | 1-(3-carbazol-9-ylphenyl)-3-[(2E,4Z)-6-phenylhepta-2,4,6-trien-3-yl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 156568725 |
| Molecular Formula | C39H29N3O2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 1-(3-carbazol-9-ylphenyl)-3-[(2E,4Z)-6-phenylhepta-2,4,6-trien-3-yl]quinazoline-2,4-dione |
| SMILES | C=C(/C=C\C(=C/C)n1c(=O)c2ccccc2n(-c2cccc(-n3c4ccccc4c4ccccc43)c2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C39H29N3O2/c1-3-29(25-24-27(2)28-14-5-4-6-15-28)42-38(43)34-20-9-12-23-37(34)41(39(42)44)31-17-13-16-30(26-31)40-35-21-10-7-18-32(35)33-19-8-11-22-36(33)40/h3-26H,2H2,1H3/b25-24-,29-3+ |
| InChIKey | RNFAVRRUZLPBMO-YXEJLUEBSA-N |
| XLogP | 8.38 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|