C47H38N4 — CID 89044983
4-[5-[5-[4-(N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]anilino)phenyl]-3-pyridinyl]-3-pyridinyl]-N,N-diphenylaniline (PubChem CID 89044983) has the molecular formula C47H38N4 and a molecular weight of 658.85 g/mol. Its IUPAC name is 4-[5-[5-[4-(N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]anilino)phenyl]-3-pyridinyl]-3-pyridinyl]-N,N-diphenylaniline.
| Compound Name | 4-[5-[5-[4-(N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]anilino)phenyl]-3-pyridinyl]-3-pyridinyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 89044983 |
| Molecular Formula | C47H38N4 |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 4-[5-[5-[4-(N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]anilino)phenyl]-3-pyridinyl]-3-pyridinyl]-N,N-diphenylaniline |
| SMILES | C=C(/C=C\C=C/C)N(c1ccccc1)c1ccc(-c2cncc(-c3cncc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C47H38N4/c1-3-4-8-15-36(2)50(43-16-9-5-10-17-43)46-26-22-37(23-27-46)39-30-41(34-48-32-39)42-31-40(33-49-35-42)38-24-28-47(29-25-38)51(44-18-11-6-12-19-44)45-20-13-7-14-21-45/h3-35H,2H2,1H3/b4-3-,15-8- |
| InChIKey | XMIPGQRRHSHXED-NHIILQCBSA-N |
| XLogP | 12.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|