C46H40N2 — CID 89086640
3-[(1E,3E)-penta-1,3-dienyl]-N-[4-[4-(N-[3-[(1E,3E)-penta-1,3-dienyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline (PubChem CID 89086640) has the molecular formula C46H40N2 and a molecular weight of 620.84 g/mol. Its IUPAC name is 3-[(1E,3E)-penta-1,3-dienyl]-N-[4-[4-(N-[3-[(1E,3E)-penta-1,3-dienyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline.
| Compound Name | 3-[(1E,3E)-penta-1,3-dienyl]-N-[4-[4-(N-[3-[(1E,3E)-penta-1,3-dienyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 89086640 |
| Molecular Formula | C46H40N2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | 3-[(1E,3E)-penta-1,3-dienyl]-N-[4-[4-(N-[3-[(1E,3E)-penta-1,3-dienyl]phenyl]anilino)phenyl]phenyl]-N-phenylaniline |
| SMILES | C/C=C/C=C/c1cccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(/C=C/C=C/C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C46H40N2/c1-3-5-9-17-37-19-15-25-45(35-37)47(41-21-11-7-12-22-41)43-31-27-39(28-32-43)40-29-33-44(34-30-40)48(42-23-13-8-14-24-42)46-26-16-20-38(36-46)18-10-6-4-2/h3-36H,1-2H3/b5-3+,6-4+,17-9+,18-10+ |
| InChIKey | RWHBOWOAGCDESG-KWVJMDKKSA-N |
| XLogP | 13.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|