C50H43N3 — CID 143477598
4-N,4-N-bis[(3Z)-penta-1,3-dien-2-yl]-1-N-phenyl-1-N-[4-[4-(N-phenylanilino)phenyl]phenyl]naphthalene-1,4-diamine (PubChem CID 143477598) has the molecular formula C50H43N3 and a molecular weight of 685.92 g/mol. Its IUPAC name is 4-N,4-N-bis[(3Z)-penta-1,3-dien-2-yl]-1-N-phenyl-1-N-[4-[4-(N-phenylanilino)phenyl]phenyl]naphthalene-1,4-diamine.
| Compound Name | 4-N,4-N-bis[(3Z)-penta-1,3-dien-2-yl]-1-N-phenyl-1-N-[4-[4-(N-phenylanilino)phenyl]phenyl]naphthalene-1,4-diamine |
|---|---|
| PubChem CID | 143477598 |
| Molecular Formula | C50H43N3 |
| Molecular Weight | 685.92 g/mol |
| Exact Mass | 685.35 |
| IUPAC Name | 4-N,4-N-bis[(3Z)-penta-1,3-dien-2-yl]-1-N-phenyl-1-N-[4-[4-(N-phenylanilino)phenyl]phenyl]naphthalene-1,4-diamine |
| SMILES | C=C(/C=C\C)N(C(=C)/C=C\C)c1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C50H43N3/c1-5-18-38(3)51(39(4)19-6-2)49-36-37-50(48-27-17-16-26-47(48)49)53(44-24-14-9-15-25-44)46-34-30-41(31-35-46)40-28-32-45(33-29-40)52(42-20-10-7-11-21-42)43-22-12-8-13-23-43/h5-37H,3-4H2,1-2H3/b18-5-,19-6- |
| InChIKey | LRVPWGFMTZTWKP-GKIHVPCKSA-N |
| XLogP | 14.43 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.92 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|