C15H20 — CID 143170529
ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-4-methylbenzene (PubChem CID 143170529) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-4-methylbenzene.
| Compound Name | ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 143170529 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | ethane;1-[(3Z)-hexa-1,3,5-trien-2-yl]-4-methylbenzene |
| SMILES | C=C/C=C\C(=C)c1ccc(C)cc1.CC |
| InChI | InChI=1S/C13H14.C2H6/c1-4-5-6-12(3)13-9-7-11(2)8-10-13;1-2/h4-10H,1,3H2,2H3;1-2H3/b6-5-; |
| InChIKey | SGHRZFLEEOVKHN-YSMBQZINSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|