C18H21I — CID 118399077
1-[(1E,4Z,5Z)-4-ethylidene-1-iodo-2-methylocta-1,5,7-trienyl]-4-methylbenzene (PubChem CID 118399077) has the molecular formula C18H21I and a molecular weight of 364.27 g/mol. Its IUPAC name is 1-[(1E,4Z,5Z)-4-ethylidene-1-iodo-2-methylocta-1,5,7-trienyl]-4-methylbenzene.
| Compound Name | 1-[(1E,4Z,5Z)-4-ethylidene-1-iodo-2-methylocta-1,5,7-trienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 118399077 |
| Molecular Formula | C18H21I |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[(1E,4Z,5Z)-4-ethylidene-1-iodo-2-methylocta-1,5,7-trienyl]-4-methylbenzene |
| SMILES | C=C/C=C\C(=C/C)C/C(C)=C(/I)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21I/c1-5-7-8-16(6-2)13-15(4)18(19)17-11-9-14(3)10-12-17/h5-12H,1,13H2,2-4H3/b8-7-,16-6+,18-15+ |
| InChIKey | BQYHYBWBIPFPDD-HCRSXHCBSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|