C10H18 — CID 143680457
(3Z,5Z)-5-ethylhepta-1,3,5-triene;methane (PubChem CID 143680457) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (3Z,5Z)-5-ethylhepta-1,3,5-triene;methane.
| Compound Name | (3Z,5Z)-5-ethylhepta-1,3,5-triene;methane |
|---|---|
| PubChem CID | 143680457 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (3Z,5Z)-5-ethylhepta-1,3,5-triene;methane |
| SMILES | C.C=C/C=C\C(=C/C)CC |
| InChI | InChI=1S/C9H14.CH4/c1-4-7-8-9(5-2)6-3;/h4-5,7-8H,1,6H2,2-3H3;1H4/b8-7-,9-5-; |
| InChIKey | KTQRNOZJDWATFA-XXAYGNTESA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|