C13H25Cl — CID 143343718
(1E,3Z,5Z)-1-chloro-5-ethylhepta-1,3,5-triene;ethane (PubChem CID 143343718) has the molecular formula C13H25Cl and a molecular weight of 216.80 g/mol. Its IUPAC name is (1E,3Z,5Z)-1-chloro-5-ethylhepta-1,3,5-triene;ethane.
| Compound Name | (1E,3Z,5Z)-1-chloro-5-ethylhepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 143343718 |
| Molecular Formula | C13H25Cl |
| Molecular Weight | 216.80 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (1E,3Z,5Z)-1-chloro-5-ethylhepta-1,3,5-triene;ethane |
| SMILES | C/C=C(\C=C/C=C/Cl)CC.CC.CC |
| InChI | InChI=1S/C9H13Cl.2C2H6/c1-3-9(4-2)7-5-6-8-10;2*1-2/h3,5-8H,4H2,1-2H3;2*1-2H3/b7-5-,8-6+,9-3-;; |
| InChIKey | FJYMGNVLPWADDE-WBKNXIFCSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.80 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|